5,6-Dimethoxyphthalaldehydic acid structure
|
Common Name | 5,6-Dimethoxyphthalaldehydic acid | ||
|---|---|---|---|---|
| CAS Number | 519-05-1 | Molecular Weight | 210.18300 | |
| Density | 1.3 g/cm3 | Boiling Point | 386.3ºC at 760 mmHg | |
| Molecular Formula | C10H10O5 | Melting Point | 145-148°C | |
| MSDS | N/A | Flash Point | 155.1ºC | |
| Name | 6-Formyl-2,3-dimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3 g/cm3 |
|---|---|
| Boiling Point | 386.3ºC at 760 mmHg |
| Melting Point | 145-148°C |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18300 |
| Flash Point | 155.1ºC |
| Exact Mass | 210.05300 |
| PSA | 72.83000 |
| LogP | 1.21450 |
| Index of Refraction | 1.573 |
| InChIKey | HVXXOIGTXJOVON-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=O)c(C(=O)O)c1OC |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Opianic acid |
| o-Veratric acid,6-formyl |
| EINECS 208-261-4 |
| MFCD00039572 |
| 2-carboxy-3,4-dimethoxybenzaldehyde |
| 5,6-dimethoxy-2-formylbenzoic acid |
| 6-formyl-2,3-dimethoxy-benzoic acid |
| 5,6-Dimethoxyphthalaldehydic acid |
| 2-formyl-5,6-dimethoxybenzoic acid |