(4-acetamidophenacyl)trimethylammonium chloride structure
|
Common Name | (4-acetamidophenacyl)trimethylammonium chloride | ||
|---|---|---|---|---|
| CAS Number | 52018-82-3 | Molecular Weight | 270.75500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(4-acetamidophenyl)-2-oxoethyl]-trimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H19ClN2O2 |
|---|---|
| Molecular Weight | 270.75500 |
| Exact Mass | 270.11400 |
| PSA | 46.17000 |
| InChIKey | SUZHCGMKGSHQOI-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)C[N+](C)(C)C)cc1.[Cl-] |
| HS Code | 2924299090 |
|---|
|
~%
(4-acetamidophe... CAS#:52018-82-3 |
| Literature: I.G. Farbenind. Patent: DE633983 , 1934 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 23, p. 483,485 |
|
~%
(4-acetamidophe... CAS#:52018-82-3 |
| Literature: Ayyangar, N. R.; Khanna, I. K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 9 p. 763 - 766 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ammonium,(p-acetamidophenacyl)trimethyl-,chloride |
| (4-Acetamidophenacyl)trimethylammonium chloride |
| 2-(4-acetamidophenyl)-n,n,n-trimethyl-2-oxoethanaminium chloride |
| EINECS 257-608-6 |