4′-Chloroacetoacetanilide structure
|
Common Name | 4′-Chloroacetoacetanilide | ||
|---|---|---|---|---|
| CAS Number | 140-49-8 | Molecular Weight | 211.645 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 400.5±30.0 °C at 760 mmHg | |
| Molecular Formula | C10H10ClNO2 | Melting Point | 216-219 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 196.0±24.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4'-(chloroacetyl)acetanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.5±30.0 °C at 760 mmHg |
| Melting Point | 216-219 °C(lit.) |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.645 |
| Flash Point | 196.0±24.6 °C |
| Exact Mass | 211.040009 |
| PSA | 46.17000 |
| LogP | 1.82 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | VMMDOCYDNRLESP-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)CCl)cc1 |
| Water Solubility | <0.1 g/100 mL at 19 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | AE1050000 |
| HS Code | 2925190090 |
|
~%
4′-Chloroacetoa... CAS#:140-49-8 |
| Literature: DE105199 ; Chemische Berichte, , vol. 33, p. 2647,2649 Chem. Zentralbl., , vol. 71, # I p. 240 |
|
~%
4′-Chloroacetoa... CAS#:140-49-8 |
| Literature: Chem. Zentralbl., , vol. 83, # I p. 134 Chem. Zentralbl., , vol. 71, # I p. 240 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Luminescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: mu-type opioid receptor isoform MOR-1 [Homo sapiens]
External Id: OPRM1-OPRD1_AG_LUMI_1536_1X%ACT PRUN
|
|
Name: Cell Viability Profiling of Human Lymphoblast Cell Lines
Source: NCGC
Target: N/A
External Id: HAPV101
|
|
Name: Caspase-3/7 Activation Profiling of Human Lymphoblast Cell Lines
Source: NCGC
Target: N/A
External Id: HAPC101
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence polarization-based biochemical high throughput primary assay to identify...
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=Sialate O-acetylesterase; AltName: Full=H-Lse; AltName: Full=Sialic acid-specific 9-O-acetylesterase; Flags: Precursor [Homo sapiens]
External Id: SIAE_INH_FP_1536_1X%INH PRUN
|
|
Name: p53 small molecule agonists, cell-based qHTS assay: qHTS cell viability counter scree...
Source: 824
Target: N/A
External Id: P53600
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: qHTS ce...
Source: 824
Target: N/A
External Id: P53MS958
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: Summary
Source: 824
External Id: P53MS482
|
| 1-Acetamido-4-chloroacetylbenzene |
| GR DMV1V1 |
| N-(4-Chlorphenyl)-3-oxobutanamide |
| N-(4-Chlorophenyl)acetoacetamide |
| 4-acetaminophenacyl chloride |
| EINECS 205-416-8 |
| N-[4-(2-chloroacetyl)phenyl]acetamide |
| MFCD00040869 |
| p-chloroacetylacetanilide |
| p-Acetamidophenacyl chloride |
| 4-acetylaminophenacyl chloride |
| N-(4-Chlorophenyl)-3-oxobutanamide |
| 4′-Chloroacetoacetanilide |
| 4'-Chloroacetoacetanilide |