Dromostanolone propionate structure
|
Common Name | Dromostanolone propionate | ||
|---|---|---|---|---|
| CAS Number | 521-12-0 | Molecular Weight | 360.530 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 445.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C23H36O3 | Melting Point | 114-120ºC | |
| MSDS | N/A | Flash Point | 190.5±28.8 °C | |
Use of Dromostanolone propionateDromostanolone propionate (Drostanolone propionate) is a compound has antitumor activity against breast carcinoma[1]. Dromostanolone propionate inhibits the uptake of oestradiol-17ß by the tumour but has no apparent effect on the uptake by normal breast tissue [2]. Dromostanolone propionate implant pellet produces weight gains in animals and suppresses estrus in female animals[3]. |
| Name | dromostanolone propionate |
|---|---|
| Synonym | More Synonyms |
| Description | Dromostanolone propionate (Drostanolone propionate) is a compound has antitumor activity against breast carcinoma[1]. Dromostanolone propionate inhibits the uptake of oestradiol-17ß by the tumour but has no apparent effect on the uptake by normal breast tissue [2]. Dromostanolone propionate implant pellet produces weight gains in animals and suppresses estrus in female animals[3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.9±45.0 °C at 760 mmHg |
| Melting Point | 114-120ºC |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.530 |
| Flash Point | 190.5±28.8 °C |
| Exact Mass | 360.266449 |
| PSA | 43.37000 |
| LogP | 5.67 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | NOTIQUSPUUHHEH-UXOVVSIBSA-N |
| SMILES | CCC(=O)OC1CCC2C3CCC4CC(=O)C(C)CC4(C)C3CCC12C |
| Storage condition | Controlled Substance, -20?C Freezer |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|
| Androstan-3-one, 2-methyl-17-(1-oxopropoxy)-, (2α,5α,17β)- |
| 2a-Methyl-17b-(1-oxopropoxy)-5a-androstan-3-one |
| Masteril |
| Dromostanolone 17-propionate |
| MDHT |
| (2α,5α,17β)-2-Methyl-3-oxoandrostan-17-yl propionate |
| Dromostanolone propionate |
| Emdisterone |
| 17β-Hydroxy-2α-methyl-5α-androstan-3-one propionate |
| EINECS 208-303-1 |
| 5α-Androstan-3-one, 17β-hydroxy-2α-methyl-, propionate |
| Drostanolone propionate |
| Masterone |
| (2α,5α,17β)-2-methyl-3-oxoandrostan-17-yl propanoate |
| Permastril |
| Medrotestron propionate |
| 2a-Methylandrostan-17b-ol-3-one Propionate |
| MFCD01669961 |
| Dromostanolone proprionate |
| Drolban |
| Masterid |
| UNII-X20UZ57G4O |
| 17b-Hydroxy-2a-methyl-5a-androstan-3-one propionate |