Angiotensin Itrifluoroacetate structure
|
Common Name | Angiotensin Itrifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 484-42-4 | Molecular Weight | 1296.48000 | |
| Density | 1.43 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C62H89N17O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Angiotensin ItrifluoroacetateAngiotensin 1 (Human) is the precursor to the vasoconstrictor peptide angiotensin II, cleaved by the angiotensin-converting enzyme (ACE). |
| Name | angiotensin i, human |
|---|---|
| Synonym | More Synonyms |
| Description | Angiotensin 1 (Human) is the precursor to the vasoconstrictor peptide angiotensin II, cleaved by the angiotensin-converting enzyme (ACE). |
|---|---|
| Related Catalog |
| Density | 1.43 g/cm3 |
|---|---|
| Molecular Formula | C62H89N17O14 |
| Molecular Weight | 1296.48000 |
| Exact Mass | 1295.68000 |
| PSA | 493.22000 |
| LogP | 3.83280 |
| Index of Refraction | 1.667 |
| InChIKey | ORWYRWWVDCYOMK-HBZPZAIKSA-N |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(=O)O)C(C)C)C(=O)NC(Cc1cnc[nH]1)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(C)C)C(=O)O |
| Storage condition | -20°C |
| Asp-Arg-Val-Tyr-Ile-His-Pro-Phe-His-Leu |
| 2MDTP |
| Drolban |
| DRVYIHPFHL-NH2 |
| H-DRVYIHPFHL-OH |
| angiotensin I |
| drostanolone propionate |
| Masterid |
| DRVYIHPFHL-OH |
| MDHT |
| 2M-DHTP |
| Re 346 |
| dromostanolone Propionate |
| rs1567 |
| Angiotensin 1 (Human) |