5-(3,4-dichlorophenyl)furan-2-carbaldehyde structure
|
Common Name | 5-(3,4-dichlorophenyl)furan-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 52130-34-4 | Molecular Weight | 241.07000 | |
| Density | 1.392g/cm3 | Boiling Point | 382.9ºC at 760 mmHg | |
| Molecular Formula | C11H6Cl2O2 | Melting Point | 140-143ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 185.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(3,4-dichlorophenyl)furan-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 382.9ºC at 760 mmHg |
| Melting Point | 140-143ºC(lit.) |
| Molecular Formula | C11H6Cl2O2 |
| Molecular Weight | 241.07000 |
| Flash Point | 185.4ºC |
| Exact Mass | 239.97400 |
| PSA | 30.21000 |
| LogP | 4.06590 |
| Index of Refraction | 1.605 |
| InChIKey | PSQLTDROSWBPGT-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932190090 |
|
~80%
5-(3,4-dichloro... CAS#:52130-34-4 |
| Literature: Bhoot, Dinesh; Khunt, Ranjan C.; Parekh, Hansa H. Medicinal Chemistry Research, 2012 , vol. 21, # 10 p. 3233 - 3239 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-(3,4-dichlorophenyl)furaldehyde |
| 5-(3,4-dichlorophenyl)-furan-2-yl-carboxaldehyde |
| 5-(3,4-Dichloro-phenyl)-furan-2-carbaldehyde |
| 5-(3,4-Dichlorophenyl)furfural |
| MFCD00448045 |
| 5-(3,4-dichlorophenyl)-2-furancarbaldehyde |
| 5-(3,4-Dichlorophenyl)-2-furaldehyde |
| 5-(3,4-Dichlorophenyl)furylaldehyde |