thiosultap-disodium structure
|
Common Name | thiosultap-disodium | ||
|---|---|---|---|---|
| CAS Number | 52207-48-4 | Molecular Weight | 355.384 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H11NNa2O6S4 | Melting Point | 194-196ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | thiosultap disodium |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 194-196ºC |
|---|---|
| Molecular Formula | C5H11NNa2O6S4 |
| Molecular Weight | 355.384 |
| Exact Mass | 354.926453 |
| PSA | 185.00000 |
| LogP | 1.46500 |
| InChIKey | QSOHVSNIQHGFJU-UHFFFAOYSA-L |
| SMILES | CN(C)C(CSS(=O)(=O)[O-])CSS(=O)(=O)[O-].[Na+].[Na+] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H311 |
| Precautionary Statements | P280-P301 + P310-P312 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 21/22-57 |
| Safety Phrases | 36/37 |
| RIDADR | UN2811 6.1/PG 3 |
| RTECS | XN6469700 |
| Hazard Class | 6.1 |
| HS Code | 2930909054 |
| HS Code | 2930909054 |
|---|---|
| Summary | 2930909054 (2e,4e)-s-ethyl 11-methoxy-3,7,11-trimethyldodeca-2,4-dienethioate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
Toxic effects of chemical pesticides (trichlorfon and dimehypo) on Dunaliella salina.
Chemosphere 84(5) , 664-70, (2011) Dunaliella salina, a unicellular green alga of environmental tolerance, was employed as test organism to investigate the toxicity effects of trichlorfon and dimehypo widely used in agriculture and vet... |
|
|
[Antidotal effect of sodium dimercapto-propane sulphonate in the treatment of acute poisoning of 2-dimethylamino-1,3-histhio-sulfopropanedisodium salt in 20 cases].
Zhonghua Nei Ke Za Zhi 32(12) , 827, (1993)
|
|
|
[Antidotal effects of 2,3-dimercaptopropane-1-sulfonate sodium (DMPS) and combined with diazepam on acute poisoning caused by sodium ammonium dimethyl-2-propano-1,3-dithiosulfate monohydrate (SCD)].
Zhonghua Yu Fang Yi Xue Za Zhi 26(4) , 213-5, (1992) In mice, DMPS (250 mg/kg, i.v.) combined with diazepam (1.25 mg/kg, i.p.) could increase LD50 of p. o. SCD 5.3 times. DMPS (62.5 mg/kg, i.v.) antagonized completely the respiratory depression and neur... |
| thiosulfuric acid (H2S2O3) SS,SS’-[2-(dimethylamino)-1,3-propanediyl] ester sodium salt (1:2) |
| UNII-2Q555U959O |
| bisultap |
| disodium S,S’-[2-(dimethylamino)propane-1,3-diyl] disulfurothioate |
| disosultap |
| dimehypo |
| Thiosultap-disodium [ISO] |
| Sha chong shuang |
| Thiosulfuric acid (HSO), S,S'-[2-(dimethylamino)-1,3-propanediyl] ester, sodium salt (1:2) |
| thiosultap-disodium |
| Disodium S,S'-(2-dimethylamino-1,3-propanediyl)bis(thiosulfate) |
| Thiosulfuric acid,S,S'-(2-(dimethylamino)-1,3-propanediyl) ester,disodium salt |
| disodium,2-(dimethylamino)-1,3-bis(sulfonatosulfanyl)propane |
| Disodium S,S'-[2-(dimethylamino)-1,3-propanediyl] disulfurothioate |
| Thiosulfuric acid, S,S'-(2-(dimethylamino)-1,3-propanediyl) ester, disodium salt |
| thiosultap-sodium |
| Disodium S,S'-[2-(dimethylamino)propane-1,3-diyl] disulfurothioate |
| MFCD01680017 |
| WSQS1YN1&1&1SSWQ &&2Na salt |
| disodium S,S’-[2-(dimethylamino)trimethylene] di(thiosulfate) |