(6,7-DIMETHOXY-1,2,3,4-TETRAHYDRO-ISOQUINOLIN-1-YL)-ACETONITRILE structure
|
Common Name | (6,7-DIMETHOXY-1,2,3,4-TETRAHYDRO-ISOQUINOLIN-1-YL)-ACETONITRILE | ||
|---|---|---|---|---|
| CAS Number | 52244-06-1 | Molecular Weight | 232.27800 | |
| Density | N/A | Boiling Point | 410.8ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O2 | Melting Point | 110-114ºC | |
| MSDS | N/A | Flash Point | 202.3ºC | |
| Name | 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 410.8ºC at 760 mmHg |
|---|---|
| Melting Point | 110-114ºC |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.27800 |
| Flash Point | 202.3ºC |
| Exact Mass | 232.12100 |
| PSA | 54.28000 |
| LogP | 2.13308 |
| InChIKey | UVGYAOQHGGLHHV-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(CC#N)NCC2 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 45-36/37/39-26 |
| HS Code | 2933499090 |
|
~67%
(6,7-DIMETHOXY-... CAS#:52244-06-1 |
| Literature: Bata, Imre; Heja, Gergely; Kiss, Pal; Korbonits, Dezso Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 9 - 12 |
|
~67%
(6,7-DIMETHOXY-... CAS#:52244-06-1 |
| Literature: Pelletier, Jeffrey C.; Cava, Michael P. Synthesis, 1987 , # 5 p. 474 - 477 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-Dimethoxy-1,2,3,4-tetrahydro-1-isoquinoline acetonitrile |