Glycerine propoxylate triacrylate structure
|
Common Name | Glycerine propoxylate triacrylate | ||
|---|---|---|---|---|
| CAS Number | 52408-84-1 | Molecular Weight | 428.47300 | |
| Density | 1.064 g/mL at 25ºC(lit.) | Boiling Point | 507.5ºC at 760 mmHg | |
| Molecular Formula | C21H32O9 | Melting Point | < -20 °C 在 1,013 百帕(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-[2,3-bis(3-prop-2-enoyloxypropoxy)propoxy]propyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.064 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 507.5ºC at 760 mmHg |
| Melting Point | < -20 °C 在 1,013 百帕(lit.) |
| Molecular Formula | C21H32O9 |
| Molecular Weight | 428.47300 |
| Flash Point | >230 °F |
| Exact Mass | 428.20500 |
| PSA | 106.59000 |
| LogP | 1.76270 |
| Index of Refraction | n20/D 1.461(lit.) |
| InChIKey | DMQYPVOQAARSNF-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCCOCC(COCCCOC(=O)C=C)OCCCOC(=O)C=C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| RTECS | TR4706500 |
| Ebecryl 53 |
| Setalux 2250 |
| Sartomer 9020 |
| MFCD00185578 |
| Glycerine propoxylate triacrylate |