Glycerine trioleate structure
|
Common Name | Glycerine trioleate | ||
|---|---|---|---|---|
| CAS Number | 122-32-7 | Molecular Weight | 885.432 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 818.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C57H104O6 | Melting Point | -5,5°C | |
| MSDS | Chinese USA | Flash Point | 302.7±31.5 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
Use of Glycerine trioleateTriolein is a symmetrical triacylglycerol, reduces MMP-1 upregulation, with strong antioxidant and anti-inflammatory properties[1]. |
| Name | triolein |
|---|---|
| Synonym | More Synonyms |
| Description | Triolein is a symmetrical triacylglycerol, reduces MMP-1 upregulation, with strong antioxidant and anti-inflammatory properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 818.7±55.0 °C at 760 mmHg |
| Melting Point | -5,5°C |
| Molecular Formula | C57H104O6 |
| Molecular Weight | 885.432 |
| Flash Point | 302.7±31.5 °C |
| Exact Mass | 884.783264 |
| PSA | 78.90000 |
| LogP | 23.71 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | PHYFQTYBJUILEZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
| Storage condition | 2-8°C |
| Stability | Stability Stable, but air and light sensitive. Incompatible with strong oxidizing agents. |
| Water Solubility | chloroform: 0.1 g/mL, clear, colorless |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H413 |
| Precautionary Statements | P210-P280 |
| Personal Protective Equipment | Eyeshields;Gloves |
| Hazard Codes | F: Flammable;Xn: Harmful; |
| Risk Phrases | R11 |
| Safety Phrases | S24/25-S39-S26 |
| RIDADR | UN 1282 3/PG 2 |
| WGK Germany | - |
| RTECS | RG1936500 |
| HS Code | 2916190090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Tumor-targeted delivery of paclitaxel using low density lipoprotein-mimetic solid lipid nanoparticles.
Mol. Pharm. 12(4) , 1230-41, (2015) Water-insoluble anticancer drugs, including paclitaxel, present severe clinical side effects when administered to patients, primarily associated with the toxicity of reagents used to solubilize the dr... |
|
|
Lactobacillus rhamnosus lowers zebrafish lipid content by changing gut microbiota and host transcription of genes involved in lipid metabolism.
Sci. Rep. 5 , 9336, (2015) The microbiome plays an important role in lipid metabolism but how the introduction of probiotic communities affects host lipid metabolism is poorly understood. Using a multidisciplinary approach we a... |
|
|
Stearic acids at sn-1, 3 positions of TAG are more efficient at limiting fat deposition than palmitic and oleic acids in C57BL/6 mice.
Br. J. Nutr. 111(7) , 1174-80, (2014) In the present study, we investigated the effect of long-acyl chain SFA, namely palmitic acid (16:0) and stearic acid (18:0), at sn-1, 3 positions of TAG on obesity. Throughout the 15 weeks of the exp... |
| Glycerin trioleate |
| Olein 9 C18:1 cis |
| Glycerol triolein |
| Triolein |
| glyceryl trioleate |
| Glycerine trioleate |
| tri-olei |
| (9Z)9-Octadecenoic acid 1,2,3-propanetriyl ester (1,2,3-Tri(cis-9-octadecenoyl)glycerol |
| 9-Octadecenoic acid (9Z)-, 1,2,3-propanetriyl ester |
| 1,2,3-tri-(9Z-octadecenoyl)-sn-glycerol |
| raoline |
| OLEIN |
| 9-Octadecenoic-9,10-t2 acid, 1,2,3-propanetriyl ester, (Z,Z,Z)- (9CI) |
| 9-Octadecenoic acid, 1,2,3-propanetriyl ester, (9Z,9'Z,9''Z)- |
| Oleic acid triglyceride |
| (9Z)9-Octadecenoic acid 1,2,3-propanetriyl ester |
| aldoto |
| 9-Octadecenoic acid (Z)-, 1,2,3-propanetriyl ester |
| 18:1TG |
| Glycerol, tri(cis-9-octadecenoate) |
| Glyceryl-1,2,3-trioleate |
| Oleic triglyceride |
| 1,2,3-Tri(cis-9-octadecenoyl)glycerol |
| Olein, tri- |
| Propane-1,2,3-triyl (9Z,9'Z,9''Z)tris-octadec-9-enoate |
| EINECS 204-534-7 |
| MFCD00137563 |
| Radia 7363 |
| Glycerol trioleate |
| 1,2,3-tri(cis-9-octadecenoyloxy)propane |
| 1,2,3-Propanetriyl (9Z,9'Z,9''Z)tris(-9-octadecenoate) |
| emery2423 |
| Erdnuoel |
| Trioleoylglyceride |