N-Boc-D-methionine structure
|
Common Name | N-Boc-D-methionine | ||
|---|---|---|---|---|
| CAS Number | 5241-66-7 | Molecular Weight | 249.327 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 415.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO4S | Melting Point | 47-50ºC | |
| MSDS | Chinese USA | Flash Point | 205.1±27.3 °C | |
Use of N-Boc-D-methionineBoc-D-Met-OH is a Methionine (HY-13694) derivative[1]. |
| Name | N-Boc-D-methionine |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-D-Met-OH is a Methionine (HY-13694) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 415.5±40.0 °C at 760 mmHg |
| Melting Point | 47-50ºC |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.327 |
| Flash Point | 205.1±27.3 °C |
| Exact Mass | 249.103485 |
| PSA | 100.93000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | IMUSLIHRIYOHEV-SSDOTTSWSA-N |
| SMILES | CSCCC(NC(=O)OC(C)(C)C)C(=O)O |
|
~97%
N-Boc-D-methionine CAS#:5241-66-7 |
| Literature: Merck and Co., Inc. Patent: US4863953 A1, 1989 ; |
|
~%
N-Boc-D-methionine CAS#:5241-66-7 |
| Literature: Lyons, Anthony Q.; Pettit, Leslie D. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1984 , p. 2305 - 2308 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| D-Methionine, N-[(1,1-dimethylethoxy)carbonyl]- |
| N-(tert-Butoxycarbonyl)-D-methionine |
| N-Boc-D-Methionine |
| EINECS 226-043-7 |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-D-methionine |
| BOC-D-Methionine |
| MFCD00038256 |
| (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid |
| Boc-D-Met-OH |
| Boc-L-Met-OH |