perfluoroheptanoyl chloride structure
|
Common Name | perfluoroheptanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 52447-22-0 | Molecular Weight | 382.50700 | |
| Density | 1.709g/cm3 | Boiling Point | 113.3ºC at 760mmHg | |
| Molecular Formula | C7ClF13O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 22.4ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.709g/cm3 |
|---|---|
| Boiling Point | 113.3ºC at 760mmHg |
| Molecular Formula | C7ClF13O |
| Molecular Weight | 382.50700 |
| Flash Point | 22.4ºC |
| Exact Mass | 381.94300 |
| PSA | 17.07000 |
| LogP | 4.49060 |
| Index of Refraction | 1.295 |
| InChIKey | IAHVCTQMGIVZJU-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Phrases | 22-34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| HS Code | 2915900090 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Tridecafluoroheptanoyl chloride |
| ACMC-20ajen |
| CTK4J5925 |
| perfluoroenanthic acid chloride |
| Perfluoroheptanoyl chloride |
| AC1MD2LV |
| 1-(Chlorocarbonyl)perfluorohexane |
| Perfluorenanthylchlorid |