1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-pyrimidine-2,4-dione structure
|
Common Name | 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 52486-19-8 | Molecular Weight | 258.23 | |
| Density | 1.576g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-pyrimidine-2,4-dione1-(β-D-Xylofuranosyl)-5-methyluracil is a thymidine analog. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
| Name | 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|
| Description | 1-(β-D-Xylofuranosyl)-5-methyluracil is a thymidine analog. Analogs of this series have insertional activity towards replicated DNA. They can be used to label cells and track DNA synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.576g/cm3 |
|---|---|
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 |
| Exact Mass | 258.08500 |
| PSA | 124.78000 |
| InChIKey | DWRXFEITVBNRMK-UHFFFAOYSA-N |
| SMILES | Cc1cn(C2OC(CO)C(O)C2O)c(=O)[nH]c1=O |
| Precursor 6 | |
|---|---|
| DownStream 3 | |