((1,3-Dioxolan-2-yl)methyl)triphenylphosphonium bromide structure
|
Common Name | ((1,3-Dioxolan-2-yl)methyl)triphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 52509-14-5 | Molecular Weight | 429.287 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22BrO2P | Melting Point | 193-195 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (1,3-Dioxolan-2-ylmethyl)triphenylphosphonium bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 193-195 °C(lit.) |
|---|---|
| Molecular Formula | C22H22BrO2P |
| Molecular Weight | 429.287 |
| Exact Mass | 428.054077 |
| PSA | 32.05000 |
| LogP | 0.35740 |
| InChIKey | FRHRVQQUICVJDG-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc([P+](CC2OCCO2)(c2ccccc2)c2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29329970 |
|
~54%
((1,3-Dioxolan-... CAS#:52509-14-5 |
| Literature: Das, Biswajit; Salman, Mohammad; Kurhade, Santosh Haribhau; Venkataramanan, Ramadass; Kumar, Rajesh; Kapkoti, Gobind Singh; Katoch, Rita; Bandyopadhyay, Anish; Rattan, Ashok Patent: US2009/170790 A1, 2009 ; Location in patent: Page/Page column 23 ; |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00011966 |
| EINECS 257-977-3 |
| (1,3-Dioxolan-2-yl)methyltriphenylphosphonium Bromide |
| (1,3-Dioxolan-2-ylmethyl)(triphenyl)phosphonium bromide |
| 1,3-dioxolan-2-ylmethyl(triphenyl)phosphanium,bromide |
| Phosphonium, (1,3-dioxolan-2-ylmethyl)triphenyl-, bromide (1:1) |
| ((1,3-Dioxolan-2-yl)methyl)triphenylphosphonium bromide |