N,N-diethyl-2,6-dinitro-4-(trifluoromethyl)aniline structure
|
Common Name | N,N-diethyl-2,6-dinitro-4-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 5254-27-3 | Molecular Weight | 307.22600 | |
| Density | 1.411g/cm3 | Boiling Point | 339.4ºC at 760mmHg | |
| Molecular Formula | C11H12F3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.1ºC | |
| Name | N,N-diethyl-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 339.4ºC at 760mmHg |
| Molecular Formula | C11H12F3N3O4 |
| Molecular Weight | 307.22600 |
| Flash Point | 159.1ºC |
| Exact Mass | 307.07800 |
| PSA | 94.88000 |
| LogP | 4.41440 |
| Index of Refraction | 1.536 |
| InChIKey | NLLHXVBITYTYHA-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine,N,N-diethyl-2,6-dinitro-4-(trifluoromethyl) |
| Nitrofor |
| N,N-Diethyl-2,6-dinitro-4-(trifluoromethyl)benzenamine |