colneleic acid structure
|
Common Name | colneleic acid | ||
|---|---|---|---|---|
| CAS Number | 52761-34-9 | Molecular Weight | 294.42900 | |
| Density | 0.957g/cm3 | Boiling Point | 437.3ºC at 760 mmHg | |
| Molecular Formula | C18H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.8ºC | |
| Name | colneleic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.957g/cm3 |
|---|---|
| Boiling Point | 437.3ºC at 760 mmHg |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.42900 |
| Flash Point | 147.8ºC |
| Exact Mass | 294.21900 |
| PSA | 46.53000 |
| LogP | 5.59210 |
| Index of Refraction | 1.49 |
| InChIKey | HHZKKFXQEIBVEV-CXXUKANQSA-N |
| SMILES | CCCCCC=CC=COC=CCCCCCCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 9-oxa-8t10t12c-18:3 |
| 9-(Nona-1',3'-dienoxy)non-8-enoic acid |
| (8E)-9-[(1E,3Z)-nona-1,3-dien-1-yloxy]non-8-enoic acid |
| (E)-9-[(1E,3Z)-nona-1,3-dienoxy]non-8-enoic acid |
| Colneleic acid |
| 9-oxa-8t10t12c-C18:3 |
| Colneleinsaeure |