silver salicylate
silver salicylate structure
|
Common Name | silver salicylate | ||
|---|---|---|---|---|
| CAS Number | 528-93-8 | Molecular Weight | 244.98100 | |
| Density | 1.375g/cm3 | Boiling Point | 336.3ºC at 760 mmHg | |
| Molecular Formula | C7H5AgO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | silver salicylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 336.3ºC at 760 mmHg |
| Molecular Formula | C7H5AgO3 |
| Molecular Weight | 244.98100 |
| Flash Point | 144.5ºC |
| Exact Mass | 243.92900 |
| PSA | 46.53000 |
| LogP | 1.01330 |
| Index of Refraction | 1.615 |
| InChIKey | NBYLLBXLDOPANK-UHFFFAOYSA-M |
| SMILES | O.O=C(O)c1ccccc1[O-].[Ag+] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
silver salicylate CAS#:528-93-8 |
| Literature: AGFA-GEVAERT N.V. Patent: EP851285 A1, 1998 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 7 | |
CAS#:33019-34-0
CAS#:20210-97-3
CAS#:73960-72-2
CAS#:82703-91-1
CAS#:82703-92-2
CAS#:82703-90-0
CAS#:133-91-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| AgO2CC6H4OH-o |
| MFCD00013976 |
| salicylic acid,silver salicylate |
| Silver salicylate hydrate |
| Silbersalicylat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of silver salicylate? |
| A: Molecular weight of silver salicylate is 244.98100. |
| Q: What is the English name of silver salicylate? |
| A: The English name of silver salicylate is silver salicylate. |
| Q: What is the InChIKey of silver salicylate? |
| A: InChIKey of silver salicylate is NBYLLBXLDOPANK-UHFFFAOYSA-M. |
| Q: What are the upstream materials of silver salicylate? |
| A: Related upstream materials(CAS) of silver salicylate: 69-72-7. |
| Q: What is the boiling point of silver salicylate? |
| A: Boiling point of silver salicylate is 336.3ºC at 760 mmHg. |
| Q: What English synonyms does silver salicylate have? |
| A: English synonyms of silver salicylate: AgO2CC6H4OH-o, MFCD00013976, salicylic acid,silver salicylate, Silver salicylate hydrate, Silbersalicylat. |
| Q: What is the polar surface area (PSA) of silver salicylate? |
| A: Polar surface area (PSA) of silver salicylate is 46.53000. |
| Q: What is the CAS number of silver salicylate? |
| A: CAS number of silver salicylate is 528-93-8. |
| Q: What is the molecular formula of silver salicylate? |
| A: Molecular formula of silver salicylate is C7H5AgO3. |
| Q: What is the LogP of silver salicylate? |
| A: LogP of silver salicylate is 1.01330. |