5-(4-chlorophenyl)furan-2-carbonitrile structure
|
Common Name | 5-(4-chlorophenyl)furan-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 52939-07-8 | Molecular Weight | 203.62400 | |
| Density | 1.32g/cm3 | Boiling Point | 324.5ºC at 760 mmHg | |
| Molecular Formula | C11H6ClNO | Melting Point | 75-79ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 150.1ºC | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 5-(4-chlorophenyl)furan-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 324.5ºC at 760 mmHg |
| Melting Point | 75-79ºC(lit.) |
| Molecular Formula | C11H6ClNO |
| Molecular Weight | 203.62400 |
| Flash Point | 150.1ºC |
| Exact Mass | 203.01400 |
| PSA | 36.93000 |
| LogP | 3.47168 |
| Index of Refraction | 1.611 |
| InChIKey | JTGMARZVNVXBRE-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(-c2ccc(Cl)cc2)o1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Risk Phrases | 25-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-(4-Chlor-phenyl)-2-cyano-furan |
| 5-(4-Chlorphenyl)-2-furonitril |
| 5-(4-Chlorophenyl)nitrile |
| 5-(p-chlorophenyl)-2-furonitrile |
| MFCD02256036 |
| 5-(4-chloro-phenyl)-furan-2-carbonitrile |
| 5-(4-Chlorophenyl)-2-furonitrile |