2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide
2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide structure
|
Common Name | 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 52961-95-2 | Molecular Weight | 248.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide (CAS: 52961-95-2, molecular formula: C12H9O4P, molecular weight: 248.17100), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9O4P |
|---|---|
| Molecular Weight | 248.17100 |
| Exact Mass | 248.02400 |
| PSA | 54.57000 |
| LogP | 3.64490 |
| InChIKey | OAELNIFYMYIQKN-UHFFFAOYSA-N |
| SMILES | O=P1(Oc2ccccc2)Oc2ccccc2O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 2 | |
CAS#:181-85-1
CAS#:1641-40-3
CAS#:108-95-2
CAS#:1499-17-8
CAS#:4591-40-6
CAS#:41850-89-9
CAS#:75-91-2
CAS#:80-15-9![2-Phenoxy-2,2'-spirobi[1,3,2-benzodioxaphosphole] structure](https://image.chemsrc.com/caspic/018/19579-02-3.png)
CAS#:19579-02-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| pyrocatechol cyclophenylphosphate |
| Phenyl-o-phenylen-phosphat |
| 2-phenoxy-2-oxo-4,5-benzo-1,3,2-dioxaphospholane |
| 1,3,2-Benzodioxaphosphole,2-phenoxy-,2-oxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide? |
| A: The English name of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide is 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide. |
| Q: What is the polar surface area (PSA) of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide? |
| A: Polar surface area (PSA) of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide is 54.57000. |
| Q: What is the SMILES notation of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide? |
| A: SMILES notation of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide is O=P1(Oc2ccccc2)Oc2ccccc2O1. |
| Q: What is the InChIKey of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide? |
| A: InChIKey of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide is OAELNIFYMYIQKN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 52961-95-2? |
| A: Chinese name of 52961-95-2 is 52961-95-2. |
| Q: What is the molecular formula of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide? |
| A: Molecular formula of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide is C12H9O4P. |
| Q: What is the molecular weight of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide? |
| A: Molecular weight of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide is 248.17100. |
| Q: What English synonyms does 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide have? |
| A: English synonyms of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide: pyrocatechol cyclophenylphosphate, Phenyl-o-phenylen-phosphat, 2-phenoxy-2-oxo-4,5-benzo-1,3,2-dioxaphospholane, 1,3,2-Benzodioxaphosphole,2-phenoxy-,2-oxide. |
| Q: What are the downstream products of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide? |
| A: Related downstream products(CAS) of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide: 1499-17-8;19579-02-3. |
| Q: What is the CAS number of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide? |
| A: CAS number of 2-phenoxy-1,3,2λ5-benzodioxaphosphole 2-oxide is 52961-95-2. |