2,3,4-trimethoxy-6-nitrobenzaldehyde structure
|
Common Name | 2,3,4-trimethoxy-6-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 52978-83-3 | Molecular Weight | 241.19700 | |
| Density | 1.304g/cm3 | Boiling Point | 425.078ºC at 760 mmHg | |
| Molecular Formula | C10H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.646ºC | |
| Name | 2,3,4-trimethoxy-6-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 425.078ºC at 760 mmHg |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.19700 |
| Flash Point | 203.646ºC |
| Exact Mass | 241.05900 |
| PSA | 90.58000 |
| LogP | 1.95630 |
| Index of Refraction | 1.558 |
| InChIKey | BARDBXITMSPPQC-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(C=O)c(OC)c1OC |
| HS Code | 2913000090 |
|---|
|
~81%
2,3,4-trimethox... CAS#:52978-83-3 |
| Literature: Carreras, Javier; Gopakumar, Gopinadhanpillai; Gu, Liangu; Gimeno, Ana; Linowski, Pawel; Petuskova, Jekaterina; Thiel, Walter; Alcarazo, Manuel Journal of the American Chemical Society, 2013 , vol. 135, # 50 p. 18815 - 18823 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2,3,4-Trimethoxy-6-nitrobenzaldehyd |
| 2-nitro-4,5,6-trimethoxybenzaldehyde |
| Benzaldehyde,2,3,4-trimethoxy-6-nitro |
| 4,5,6-trimethoxy-2-nitrobenzaldehyde |
| 6-Nitro-2,3,4-trimethoxybenzaldehyde |
| 2-nitro-3,4,5-trimethoxybenzaldehyde |