METHYL 3-METHOXY-2-NITROBENZOATE structure
|
Common Name | METHYL 3-METHOXY-2-NITROBENZOATE | ||
|---|---|---|---|---|
| CAS Number | 5307-17-5 | Molecular Weight | 258.354 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 404.5±28.0 °C at 760 mmHg | |
| Molecular Formula | C14H26O4 | Melting Point | 142-144ºC | |
| MSDS | N/A | Flash Point | 212.6±20.5 °C | |
| Name | Methyl 3-Methoxy-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 404.5±28.0 °C at 760 mmHg |
| Melting Point | 142-144ºC |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.354 |
| Flash Point | 212.6±20.5 °C |
| Exact Mass | 258.183105 |
| PSA | 81.35000 |
| LogP | 3.26 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | FDQQRLPHAAICCR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(OC)c1[N+](=O)[O-] |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2918990090 |
|
~%
METHYL 3-METHOX... CAS#:5307-17-5 |
| Literature: WO2005/113509 A1, ; Page/Page column 121 ; |
|
~%
METHYL 3-METHOX... CAS#:5307-17-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 22, # 15 p. 5031 - 5034 |
|
~%
METHYL 3-METHOX... CAS#:5307-17-5 |
| Literature: Australian Journal of Chemistry, , vol. 29, p. 2003 - 2021 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 2-Nitro-m-anisate |
| MFCD00051968 |
| 2,2,9,9-Tetramethyldecanedioic acid |
| methyl 3-methoxy-2-nitrobenzoate |
| 3-Methoxy-2-nitrobenzoic Acid Methyl Ester |
| Decanedioic acid, 2,2,9,9-tetramethyl- |
| 2-Nitro-m-anisic Acid Methyl Ester |