2,5,7,8-tetramethyl-3,4-dihydrochromene-2,6-diol
Modify Date: 2024-01-09 14:19:58
2,5,7,8-tetramethyl-3,4-dihydrochromene-2,6-diol structure
|
Common Name | 2,5,7,8-tetramethyl-3,4-dihydrochromene-2,6-diol | ||
|---|---|---|---|---|
| CAS Number | 53101-68-1 | Molecular Weight | 222.28000 | |
| Density | 1.17g/cm3 | Boiling Point | 390.1ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5,7,8-tetramethyl-3,4-dihydrochromene-2,6-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760 mmHg |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Exact Mass | 222.12600 |
| PSA | 49.69000 |
| LogP | 2.35090 |
| Index of Refraction | 1.572 |
| InChIKey | BTFSFQNWGHJWJH-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(O)O2 |
| HS Code | 2932999099 |
|---|
|
~%
2,5,7,8-tetrame... CAS#:53101-68-1 |
| Literature: Hoffman-La Roche Inc. Patent: US3947473 A1, 1976 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dihydroxy-2,5,7,8-tetramethylchroman |
| 2,5,7,8-Tetramethyl-chroman-2,6-diol |
| 3,4-dihydro-2,5,7,8-tetramethyl-2H-1-benzopyran-2,6-diol |
| 2-hydroxy-2,5,7,8-tetramethylchroman-6-ol |
| 2H-1-Benzopyran-2,6-diol,3,4-dihydro-2,5,7,8-tetramethyl |
| 2,5,7,8-tetramethylchromane-2,6-diol |
| 2-hydroxy-2,2,5,7,8-pentamethylchroman-6-ol |