Benzenesulfonamide,N-(3-acetylphenyl)-4-methyl- structure
|
Common Name | Benzenesulfonamide,N-(3-acetylphenyl)-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 5317-87-3 | Molecular Weight | 289.35000 | |
| Density | 1.278g/cm3 | Boiling Point | 456.9ºC at 760mmHg | |
| Molecular Formula | C15H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.1ºC | |
| Name | 3'-acetyl-p-toluenesulfonanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 456.9ºC at 760mmHg |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.35000 |
| Flash Point | 230.1ºC |
| Exact Mass | 289.07700 |
| PSA | 71.62000 |
| LogP | 4.15220 |
| Index of Refraction | 1.604 |
| InChIKey | LTJWGOUGWAHTNP-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)c2ccc(C)cc2)c1 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenesulfonam... CAS#:5317-87-3 |
| Literature: Seo, Woo Duck; Kim, Jin Hyo; Kang, Jae Eun; Ryu, Hyung Won; Curtis-Long, Marcus J.; Lee, Hyun Sun; Yang, Min Suk; Park, Ki Hun Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 24 p. 5514 - 5516 |
|
~%
Benzenesulfonam... CAS#:5317-87-3 |
| Literature: Uloth; Kirk; Gould; Larsen Journal of medicinal chemistry, 1966 , vol. 9, # 1 p. 88 - 97 |
|
~%
Benzenesulfonam... CAS#:5317-87-3 |
| Literature: Elson; Gibson; Johnson Journal of the Chemical Society, 1930 , p. 1128,1131 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| toluene-4-sulfonic acid-(3-acetyl-anilide) |
| 1-[3-(Toluol-sulfonyl-(4)-amino)-phenyl]-aethanon-(1) |
| 1-(5-(1,1-Dimethylethyl)-1H-pyrazol-3-yl)-5-hydroxy-3-methyl-2-pyrrolidinone |
| N-(3-acetylphenyl)-4-methylbenzenesulfonamide |
| 2-Pyrrolidinone,1-[5-(1,1-dimethylethyl)-1H-pyrazol-3-yl]-5-hydroxy-3-methyl |
| 1-[3-(t-butyl)-1H-pyrazol-5-yl]-5-hydroxy-3-methyl-2-pyrrolidinone |
| Toluol-4-sulfonsaeure-(3-acetyl-anilid) |