2''-O-Galloylhyperin structure
|
Common Name | 2''-O-Galloylhyperin | ||
|---|---|---|---|---|
| CAS Number | 53209-27-1 | Molecular Weight | 616.481 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 1106.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C28H24O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.6±27.8 °C | |
Use of 2''-O-Galloylhyperin2"-O-Galloylhyperin, an active compound isolated from Pyrola incarnate Fisch., possesses anti-oxidative and anti-inflammatory activities. 2"-O-Galloylhyperin has hepatoprotective effect against oxidative stress-induced liver damage[1][2]. |
| Name | [6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-2,3-dihydroxy-4-(hydroxymethyl)cyclohexyl] 3,5-dihydroxy-4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | 2"-O-Galloylhyperin, an active compound isolated from Pyrola incarnate Fisch., possesses anti-oxidative and anti-inflammatory activities. 2"-O-Galloylhyperin has hepatoprotective effect against oxidative stress-induced liver damage[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 1106.9±65.0 °C at 760 mmHg |
| Molecular Formula | C28H24O16 |
| Molecular Weight | 616.481 |
| Flash Point | 365.6±27.8 °C |
| Exact Mass | 616.106445 |
| PSA | 277.27000 |
| LogP | 3.61 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.838 |
| InChIKey | PXGWEUQZDRUMRE-UNZYZCBSSA-N |
| SMILES | O=C(OC1C(Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)OC(CO)C(O)C1O)c1cc(O)c(O)c(O)c1 |
| Storage condition | 2-8C |
| HS Code | 29389090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl 2-O-(3,4,5-trihydroxybenzoyl)-β-D-galactopyranoside |
| 2'-O-(2-METHOXYETHYL)CYTIDINE |
| 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[[2-O-(3,4,5-trihydroxybenzoyl)-β-D-galactopyranosyl]oxy]- |
| 2"-O-Galloylhyperin |
| 2''-O-Galloylhyperin |