2-Chloro-4-(methylsulfonyl)benzoic acid structure
|
Common Name | 2-Chloro-4-(methylsulfonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 53250-83-2 | Molecular Weight | 234.657 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 454.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H7ClO4S | Melting Point | 192-193 °C | |
| MSDS | N/A | Flash Point | 228.8±28.7 °C | |
| Name | 2-Chloro-4-(Methylsulfonyl)Benzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 454.8±45.0 °C at 760 mmHg |
| Melting Point | 192-193 °C |
| Molecular Formula | C8H7ClO4S |
| Molecular Weight | 234.657 |
| Flash Point | 228.8±28.7 °C |
| Exact Mass | 233.975357 |
| PSA | 79.82000 |
| LogP | 1.18 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | CTTWSFIIFMWHLQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38;R41 |
| Safety Phrases | S36/37/39-S26-S22-S39 |
|
~%
2-Chloro-4-(met... CAS#:53250-83-2 |
| Literature: Journal of Organic Chemistry, , vol. 56, # 16 p. 4974 - 4976 |
|
~%
2-Chloro-4-(met... CAS#:53250-83-2 |
| Literature: Journal of Organic Chemistry, , vol. 56, # 16 p. 4974 - 4976 |
| WS1&R CG DVQ |
| EINECS 406-520-8 |
| 2-Chloro-4-(methylsulfonyl)benzoic acid |
| 2-Chloro-4-methylsulfonylbenzoic acid |
| MFCD00216496 |
| 2-Chloro-4-methylsulphonylbenzoic acid |
| Benzoic acid, 2-chloro-4-(methylsulfonyl)- |