a-Aleuritic Acid structure
|
Common Name | a-Aleuritic Acid | ||
|---|---|---|---|---|
| CAS Number | 533-87-9 | Molecular Weight | 304.422 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 516.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H32O5 | Melting Point | 100-101 °C(lit.) | |
| MSDS | N/A | Flash Point | 280.4±25.2 °C | |
Use of a-Aleuritic AcidAleuritic acid ((±)-erythro-Aleuritic acid) is a major ingredient in shellac and used in the perfumery industry[1]. |
| Name | aleuritic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Aleuritic acid ((±)-erythro-Aleuritic acid) is a major ingredient in shellac and used in the perfumery industry[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 516.7±45.0 °C at 760 mmHg |
| Melting Point | 100-101 °C(lit.) |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.422 |
| Flash Point | 280.4±25.2 °C |
| Exact Mass | 304.224976 |
| PSA | 97.99000 |
| LogP | 1.27 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | MEHUJCGAYMDLEL-CABCVRRESA-N |
| SMILES | O=C(O)CCCCCCCC(O)C(O)CCCCCCO |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Safety Phrases | S22-S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | ML9850000 |
| HS Code | 2918199090 |
|
~%
a-Aleuritic Acid CAS#:533-87-9 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 32, # 4 p. 487 - 488 |
a-Aleuritic Acid CAS#:533-87-9 ~%
a-Aleuritic Acid CAS#:533-87-9 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 14, p. 220 - 222 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Aleuritic Acid |
| (±)-erythro-Aleuritic Acid |
| (9S,10R)-9,10,16-Trihydroxyhexadecanoic acid |
| threo-aleuritic acid |
| DL-erythro-Aleuritic acid |
| α-Aleuritic acid |
| TRIHYDROXYHEXADECANOICACID |
| syntheticaleuriticacid |
| (+-)-threo-9,10,16-trihydroxy-hexadecanoic acid |
| Albopilosin A Aleuritic acid |
| EINECS 232-692-7 |
| 8,9,15-Trihydroxypentadecane-1-carboxylic acid |
| (‘±)-erythro-Aleuritic acid |
| Alpha-Aleuritic Acid |
| Trihydroxyhexadecanoic acid |
| a-Aleuritic Acid |
| aleuriticacid,tech. |
| erythro-Aleuritic Acid |
| (R*,S*)-(±)-9,10,16-Trihydroxyhexadecanoic acid |
| 9,10,16-Trihydroxypalmitic acid |
| MFCD00135596 |