3-Nitro-5-(trifluoromethyl)-2-pyridinamine structure
|
Common Name | 3-Nitro-5-(trifluoromethyl)-2-pyridinamine | ||
|---|---|---|---|---|
| CAS Number | 53359-69-6 | Molecular Weight | 207.110 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 273.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C6H4F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.4±27.3 °C | |
| Name | 3-Nitro-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 273.9±40.0 °C at 760 mmHg |
| Molecular Formula | C6H4F3N3O2 |
| Molecular Weight | 207.110 |
| Flash Point | 119.4±27.3 °C |
| Exact Mass | 207.025558 |
| PSA | 84.73000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | LHUVKANNSWTRJI-UHFFFAOYSA-N |
| SMILES | Nc1ncc(C(F)(F)F)cc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~76%
3-Nitro-5-(trif... CAS#:53359-69-6 |
| Literature: Sapegin, Alexander V.; Kalinin, Stanislav A.; Smirnov, Alexey V.; Dorogov, Mikhail V.; Krasavin, Mikhail Tetrahedron, 2014 , vol. 70, # 5 p. 1077 - 1083 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Nitro-5-(trifluoromethyl)-2-pyridinamine |
| 2-pyridinamine, 3-nitro-5-(trifluoromethyl)- |
| 3-nitro-5-(trifluoromethyl)pyridin-2-amine |