3-Nitro-5-trifluoromethyl-pyridine-2-carbonitrile structure
|
Common Name | 3-Nitro-5-trifluoromethyl-pyridine-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 866775-16-8 | Molecular Weight | 217.105 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 313.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H2F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.3±27.9 °C | |
| Name | 3-nitro-5-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 313.3±42.0 °C at 760 mmHg |
| Molecular Formula | C7H2F3N3O2 |
| Molecular Weight | 217.105 |
| Flash Point | 143.3±27.9 °C |
| Exact Mass | 217.009918 |
| PSA | 82.50000 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | UZSOJPPOSGGMMB-UHFFFAOYSA-N |
| SMILES | N#Cc1ncc(C(F)(F)F)cc1[N+](=O)[O-] |
|
~54%
3-Nitro-5-trifl... CAS#:866775-16-8 |
| Literature: ELI LILLY AND COMPANY Patent: WO2005/97805 A1, 2005 ; Location in patent: Page/Page column 62 ; |
|
~%
3-Nitro-5-trifl... CAS#:866775-16-8 |
| Literature: NOVARTIS AG; BALA, Kamlesh, Jagdis; BUTLER, Rebecca; COLLINGWOOD, Stephen, Paul; HALL, Edward, Charles; EDWARDS, Lee; LEGRAND, Darren, Mark; SPIEGEL, Katrin Patent: WO2013/38386 A1, 2013 ; Location in patent: Page/Page column 81 ; |
|
~%
3-Nitro-5-trifl... CAS#:866775-16-8 |
| Literature: NOVARTIS AG Patent: US2011/230483 A1, 2011 ; |
| 3-nitro-5-trifluoromethyl-pyridin-2-carbonitrile |
| 2-Pyridinecarbonitrile, 3-nitro-5-(trifluoromethyl)- |
| 3-nitro-5-trifluoromethyl-pyridine-2-carbonitrile |
| 2-cyano-3-nitro-5-(trifluoromethyl)pyridine |
| 3-NITRO-5-(TRIFLUOROMETHYL)PICOLINONITRILE |
| 3-nitro-5-(trifluoromethyl)pyridine-2-carbonitrile |
| I02-1811 |
| 3-Nitro-5-(trifluoromethyl)-2-pyridinecarbonitrile |