1-(BROMOMETHYL)-4,5-DIMETHOXY-2-NITROBENZENE structure
|
Common Name | 1-(BROMOMETHYL)-4,5-DIMETHOXY-2-NITROBENZENE | ||
|---|---|---|---|---|
| CAS Number | 53413-67-5 | Molecular Weight | 276.08400 | |
| Density | 1.544g/cm3 | Boiling Point | 372.3ºC at 760mmHg | |
| Molecular Formula | C9H10BrNO4 | Melting Point | 131-133ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 179ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4,5-Dimethoxy-2-nitrobenzyl bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.544g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760mmHg |
| Melting Point | 131-133ºC(lit.) |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.08400 |
| Flash Point | 179ºC |
| Exact Mass | 274.97900 |
| PSA | 64.28000 |
| LogP | 3.03010 |
| Index of Refraction | 1.571 |
| InChIKey | UEKFEYNZISYRRH-UHFFFAOYSA-N |
| SMILES | COc1cc(CBr)c([N+](=O)[O-])cc1OC |
| Storage condition | 2-8°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | R34 |
| Safety Phrases | 22-26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| Packaging Group | III |
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Caged vanilloid ligands for activation of TRPV1 receptors by 1- and 2-photon excitation.
Biochemistry 45(15) , 4915-26, (2006) Nociceptive neurons in the peripheral nervous system detect noxious stimuli and report the information to the central nervous system. Most nociceptive neurons express the vanilloid receptor, TRPV1, a ... |
|
|
Bright building blocks for chemical biology.
ACS Chem. Biol. 9(4) , 855-66, (2014) Small-molecule fluorophores manifest the ability of chemistry to solve problems in biology. As we noted in a previous review (Lavis, L. D.; Raines, R. T. ACS Chem. Biol. 2008, 3, 142-155), the extant ... |
|
|
Spatially discrete, light-driven protein expression.
Chem. Biol. 9(12) , 1347-53, (2002) Transgene-based inducible expression systems offer the potential to study the influence of any gene at any point during an organism's lifetime. However, the expression of individual genes is both temp... |
| 1-(Bromomethyl)-4,5-dimethoxy-2-nitrobenzene |
| MFCD00192064 |