benzoyloxymethyl benzoate structure
|
Common Name | benzoyloxymethyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 5342-31-4 | Molecular Weight | 256.25300 | |
| Density | 1.222g/cm3 | Boiling Point | 409ºC at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.4ºC | |
| Name | benzoyloxymethyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 409ºC at 760 mmHg |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 208.4ºC |
| Exact Mass | 256.07400 |
| PSA | 52.60000 |
| LogP | 2.65790 |
| Index of Refraction | 1.576 |
| InChIKey | BDDYZHKLKHFEBJ-UHFFFAOYSA-N |
| SMILES | O=C(OCOC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Dibenzocarboxymethane |
| bismethylene benzoate |
| methylene dibenzoate |
| methylidene dibenzoate |
| METHANEDIOL,DIBENZOATE |
| methanediyl dibenzoate |
| benzoic acid methylene diester |
| (benzoyloxy)methyl benzoate |
| bis-benzoyloxy-methane |