1,4-Naphthalenedione,2-chloro-3-(ethylamino)- structure
|
Common Name | 1,4-Naphthalenedione,2-chloro-3-(ethylamino)- | ||
|---|---|---|---|---|
| CAS Number | 5349-87-1 | Molecular Weight | 235.66600 | |
| Density | 1.33g/cm3 | Boiling Point | 337.8ºC at 760mmHg | |
| Molecular Formula | C12H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1ºC | |
| Name | 2-chloro-3-(ethylamino)naphthalene-1,4-dione |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 337.8ºC at 760mmHg |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.66600 |
| Flash Point | 158.1ºC |
| Exact Mass | 235.04000 |
| PSA | 46.17000 |
| LogP | 2.51640 |
| Index of Refraction | 1.605 |
| InChIKey | XBADMYUFDWBDLJ-UHFFFAOYSA-N |
| SMILES | CCNC1=C(Cl)C(=O)c2ccccc2C1=O |
|
~91%
1,4-Naphthalene... CAS#:5349-87-1 |
| Literature: Lien, Jin-Cherng; Huang, Li-Jiau; Wang, Jih-Pyang; Teng, Che-Ming; Lee, Kuo-Hsiung; Kou, Sheng-Chu Bioorganic and Medicinal Chemistry, 1997 , vol. 5, # 12 p. 2111 - 2120 |
|
~%
1,4-Naphthalene... CAS#:5349-87-1 |
| Literature: Plagemann Chemische Berichte, 1882 , vol. 15, p. 485 Anm. 1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |