1,2,3-Trielaidoyl Glycerol structure
|
Common Name | 1,2,3-Trielaidoyl Glycerol | ||
|---|---|---|---|---|
| CAS Number | 537-39-3 | Molecular Weight | 885.43200 | |
| Density | 0.921g/cm3 | Boiling Point | 818.7ºC at 760mmHg | |
| Molecular Formula | C57H104O6 | Melting Point | 42ºC | |
| MSDS | USA | Flash Point | 302.6ºC | |
Use of 1,2,3-Trielaidoyl GlycerolTrielaidin is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | trielaidin |
|---|---|
| Synonym | More Synonyms |
| Description | Trielaidin is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 0.921g/cm3 |
|---|---|
| Boiling Point | 818.7ºC at 760mmHg |
| Melting Point | 42ºC |
| Molecular Formula | C57H104O6 |
| Molecular Weight | 885.43200 |
| Flash Point | 302.6ºC |
| Exact Mass | 884.78300 |
| PSA | 78.90000 |
| LogP | 18.09710 |
| Index of Refraction | 1.4381 (estimate) |
| InChIKey | PHYFQTYBJUILEZ-WUOFIQDXSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | - |
| HS Code | 2916190090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Trielaidin 9 C18:1 trans |
| 1-hydroxyoctadec-9-ene |
| TRIELAIDIN |
| Glyceryl trielaidate |
| 9-octadecenol |
| MFCD00067496 |
| glyceryl trioleate |
| trans-9-Octadecen-1-ol |
| Glycerol Elaidate |
| Glycerol 1,2,3-tri(trans-9-octadecenoate) Trielaidin |
| TRANS-9-OCTADECENOL |
| ELAIDYL ALCOHOL |
| 9-octadecen-1-ol |
| EINECS 208-665-0 |
| elaidic alcohol |
| 1,2,3-Tri(trans-9-octadecenoyl) Glycerol |