4,4'-Iminodianiline structure
|
Common Name | 4,4'-Iminodianiline | ||
|---|---|---|---|---|
| CAS Number | 537-65-5 | Molecular Weight | 199.25 | |
| Density | 1.245g/cm3 | Boiling Point | 410.7ºC at 760mmHg | |
| Molecular Formula | C12H13N3 | Melting Point | 158°C | |
| MSDS | N/A | Flash Point | 239.2ºC | |
| Name | N1-(4-Aminophenyl)benzene-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 410.7ºC at 760mmHg |
| Melting Point | 158°C |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.25 |
| Flash Point | 239.2ºC |
| Exact Mass | 199.110947427 |
| PSA | 147.05000 |
| LogP | 4.25800 |
| Index of Refraction | 1.609 |
| InChIKey | QZHXKQKKEBXYRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC2=CC=C(C=C2)N |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921590090 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-N-(4-aminophenyl)benzene-1,4-diamine |