Parazoanthoxanthine A structure
|
Common Name | Parazoanthoxanthine A | ||
|---|---|---|---|---|
| CAS Number | 53823-11-3 | Molecular Weight | 214.22700 | |
| Density | 1.79g/cm3 | Boiling Point | 556.3ºC at 760 mmHg | |
| Molecular Formula | C10H10N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.2ºC | |
| Name | parazoanthoxanthin a |
|---|---|
| Synonym | More Synonyms |
| Density | 1.79g/cm3 |
|---|---|
| Boiling Point | 556.3ºC at 760 mmHg |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.22700 |
| Flash Point | 290.2ºC |
| Exact Mass | 214.09700 |
| PSA | 106.50000 |
| LogP | 2.14130 |
| Index of Refraction | 1.927 |
| InChIKey | SHHMMSFAIOQFON-UHFFFAOYSA-N |
| SMILES | Cc1c2nc(N)nc-2ccc2[nH]c(N)nc12 |
|
~15%
Parazoanthoxant... CAS#:53823-11-3 |
| Literature: Xu, Ying-zi; Yakushijin, Kenichi; Horne, David A. Tetrahedron Letters, 1992 , vol. 33, # 31 p. 4385 - 4388 |
|
~%
Parazoanthoxant... CAS#:53823-11-3 |
| Literature: Xu, Ying-Zi; Yakushijin, Kenichi; Horne, David A. Journal of Organic Chemistry, 1996 , vol. 61, # 26 p. 9569 - 9571 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-methyl-1H-cyclohepta[1,2-d,4,5-d']diimidazole-2,6-diamine |