2-Aminoimidazole hemisulfate structure
|
Common Name | 2-Aminoimidazole hemisulfate | ||
|---|---|---|---|---|
| CAS Number | 1450-93-7 | Molecular Weight | 264.262 | |
| Density | N/A | Boiling Point | 313.1ºC at 760 mmHg | |
| Molecular Formula | C6H12N6O4S | Melting Point | 270 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 168.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Aminoimidazole hemisulfate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 313.1ºC at 760 mmHg |
|---|---|
| Melting Point | 270 °C (dec.)(lit.) |
| Molecular Formula | C6H12N6O4S |
| Molecular Weight | 264.262 |
| Flash Point | 168.9ºC |
| Exact Mass | 264.064087 |
| PSA | 192.38000 |
| LogP | 1.57420 |
| Vapour Pressure | 0.000506mmHg at 25°C |
| InChIKey | KUWRLKJYNASPQZ-UHFFFAOYSA-N |
| SMILES | Nc1ncc[nH]1.Nc1ncc[nH]1.O=S(=O)(O)O |
| Storage condition | Keep Cold |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2942000000 |
|
~83%
2-Aminoimidazol... CAS#:1450-93-7 |
| Literature: Weinmann, Hilmar; Harre, Michael; Koenig, Klaus; Merten, Erik; Tilstam, Ulf Tetrahedron Letters, 2002 , vol. 43, # 4 p. 593 - 595 |
|
~%
2-Aminoimidazol... CAS#:1450-93-7 |
| Literature: Tetrahedron Letters, , vol. 43, # 4 p. 593 - 595 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
A short synthesis of the marine bioactive metabolite (+/−) girolline.
Tetrahedron Lett. 39(44) , 8085-8088, (1998)
|
| 1H-Imidazol-2-amine Sulfate |
| 2-Aminoimidazolium Sulfat |
| MFCD00013162 |
| 1H-Imidazol-2-amine, sulfate (2:1) |
| 2-aminoimidazolium sulphate |
| 2-amino-imidazole hemisulfate |
| Bis(2-aminoimidazole) Sulfate |
| 2-Aminoimidazole Hemisulfate |
| 1H-imidazol-2-amine sulfate(2:1) |
| 2-AMINOIMIDAZOLE SULFATE |
| 2-IMIDAZOLEAMINE SULFATE |
| 2-Aminoimidazolium sulfate |
| 2-AMINOIMIDAZOLE SULPHATE |
| 2-Aminoimidazole monosulfate |
| 2-Aminoimidazole sul |
| 1H-Imidazol-2-amine sulfate (2:1) |
| EINECS 215-918-9 |