γ-carboxy-L-glutamic acid structure
|
Common Name | γ-carboxy-L-glutamic acid | ||
|---|---|---|---|---|
| CAS Number | 53861-57-7 | Molecular Weight | 191.13900 | |
| Density | 1.649 g/cm3 | Boiling Point | 418ºC at 760 mmHg | |
| Molecular Formula | C6H9NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.6ºC | |
| Name | γ-carboxy-L-glutamic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.649 g/cm3 |
|---|---|
| Boiling Point | 418ºC at 760 mmHg |
| Molecular Formula | C6H9NO6 |
| Molecular Weight | 191.13900 |
| Flash Point | 206.6ºC |
| Exact Mass | 191.04300 |
| PSA | 137.92000 |
| Index of Refraction | 1.569 |
| InChIKey | UHBYWPGGCSDKFX-VKHMYHEASA-N |
| SMILES | NC(CC(C(=O)O)C(=O)O)C(=O)O |
| HS Code | 2922499990 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| gamma-carboxy-L-glutamic acid |
| (3S)-3-aminopropane-1,1,3-tricarboxylic acid |
| AmbotzHAA1082 |
| L-Gla-OH |
| H-L-Gla-OH |
| g-carboxyglutamic acid |