b-(4- Chlorophenyl) glutaric anhydride structure
|
Common Name | b-(4- Chlorophenyl) glutaric anhydride | ||
|---|---|---|---|---|
| CAS Number | 53911-68-5 | Molecular Weight | 224.640 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 393.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.0±26.9 °C | |
| Name | 4-(4-Chlorophenyl)dihydro-2H-pyran-2,6(3H)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 393.2±42.0 °C at 760 mmHg |
| Molecular Formula | C11H9ClO3 |
| Molecular Weight | 224.640 |
| Flash Point | 176.0±26.9 °C |
| Exact Mass | 224.024017 |
| PSA | 43.37000 |
| LogP | 1.33 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | OCZRLOJECISNAO-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccc(Cl)cc2)CC(=O)O1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917399090 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(4-Chlorophenyl)dihydro-2H-pyran-2,6(3H)-dione |
| 2H-Pyran-2,6(3H)-dione, 4-(4-chlorophenyl)dihydro- |
| b-(4- Chlorophenyl) glutaric anhydride |
| β-(4-CHLOROPHENYL)GLUTARIC ANHYDRIDE |