1H-Indole-3-methanamine,N-cyclohexyl- structure
|
Common Name | 1H-Indole-3-methanamine,N-cyclohexyl- | ||
|---|---|---|---|---|
| CAS Number | 53924-03-1 | Molecular Weight | 228.33300 | |
| Density | 1.09g/cm3 | Boiling Point | 405.3ºC at 760 mmHg | |
| Molecular Formula | C15H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.9ºC | |
| Name | N-(1H-indol-3-ylmethyl)cyclohexanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 405.3ºC at 760 mmHg |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.33300 |
| Flash Point | 198.9ºC |
| Exact Mass | 228.16300 |
| PSA | 27.82000 |
| LogP | 3.98110 |
| Index of Refraction | 1.61 |
| InChIKey | MAMUGDCJLAKCPT-UHFFFAOYSA-N |
| SMILES | c1ccc2c(CNC3CCCCC3)c[nH]c2c1 |
| HS Code | 2933990090 |
|---|
|
~99%
1H-Indole-3-met... CAS#:53924-03-1 |
| Literature: Ross, Nathan T.; Deane, Rashid; Perry, Sheldon; Miller, Benjamin L. Tetrahedron, 2013 , vol. 69, # 36 p. 7653 - 7658 |
|
~%
1H-Indole-3-met... CAS#:53924-03-1 |
| Literature: Katritzky; Yang; Lam Tetrahedron, 1992 , vol. 48, # 23 p. 4971 - 4978 |
|
~92%
1H-Indole-3-met... CAS#:53924-03-1 |
| Literature: Afsah, El-Sayed M.; Jackson, Anthony H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 8 p. 1929 - 1932 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Cyclohexylaminomethyl-indol |
| cyclohexyl-indol-3-ylmethyl-amine |
| N-cyclohexyl-1H-indole-3-methylamine |
| N-indol-3-ylmethylcyclohexylamine |
| 3-(cyclohexylaminomethyl)indole |
| 3-(CyNHCH2)C8H5NH |