1H-Indole-3-methanamine,N,N-dimethyl-, N-oxide structure
|
Common Name | 1H-Indole-3-methanamine,N,N-dimethyl-, N-oxide | ||
|---|---|---|---|---|
| CAS Number | 17206-03-0 | Molecular Weight | 189.23400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | gramine, n-oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13N2O |
|---|---|
| Molecular Weight | 189.23400 |
| Exact Mass | 189.10300 |
| PSA | 32.67000 |
| LogP | 1.97190 |
| InChIKey | GHUNMFJGWZLOFB-UHFFFAOYSA-N |
| SMILES | C[N+](C)([O-])Cc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
1H-Indole-3-met... CAS#:17206-03-0 |
| Literature: Henry; Leete Journal of the American Chemical Society, 1957 , vol. 79, p. 5254 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Indole-3-magnesium iodide |
| indol-3-ylmethyl-dimethyl-amine oxide |
| indol-3-yliodomagnesium |
| Gramin-N'-oxid |
| Magnesium,1H-indol-3-yliodo |
| indolylmagnesium iodide |
| Indol-3-ylmethyl-dimethyl-aminoxid |