2,4-BPS structure
|
Common Name | 2,4-BPS | ||
|---|---|---|---|---|
| CAS Number | 5397-34-2 | Molecular Weight | 250.270 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 487.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C12H10O4S | Melting Point | 184°C | |
| MSDS | N/A | Flash Point | 248.5±24.6 °C | |
| Name | 2,4'-Dihydroxydiphenyl Sulfone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.2±30.0 °C at 760 mmHg |
| Melting Point | 184°C |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.270 |
| Flash Point | 248.5±24.6 °C |
| Exact Mass | 250.029984 |
| PSA | 82.98000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | LROZSPADHSXFJA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(O)cc1)c1ccccc1O |
| Storage condition | 2-8 °C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2908999090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-((4-Hydroxyphenyl)sulfonyl)phenol |
| 2-(4-hydroxyphenyl)sulfonylphenol |
| EINECS 226-421-1 |
| 2-[(4-Hydroxyphenyl)sulfonyl]phenol |
| 2,4-BPS |
| MFCD01631305 |
| Phenol, 2-[(4-hydroxyphenyl)sulfonyl]- |