Ethyl 4,6-dichloro-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 4,6-dichloro-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 53995-82-7 | Molecular Weight | 258.101 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 405.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H9Cl2NO2 | Melting Point | 171-172ºC | |
| MSDS | N/A | Flash Point | 198.7±27.3 °C | |
| Name | Ethyl 4,6-dichloro-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 405.0±40.0 °C at 760 mmHg |
| Melting Point | 171-172ºC |
| Molecular Formula | C11H9Cl2NO2 |
| Molecular Weight | 258.101 |
| Flash Point | 198.7±27.3 °C |
| Exact Mass | 257.001038 |
| PSA | 42.09000 |
| LogP | 4.30 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | YLAHLUPONQVSOT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2c(Cl)cc(Cl)cc2[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~99%
Ethyl 4,6-dichl... CAS#:53995-82-7 |
| Literature: SANKYO COMPANY, LIMITED Patent: WO2006/109633 A1, 2006 ; Location in patent: Page/Page column 182-183 ; |
|
~%
Ethyl 4,6-dichl... CAS#:53995-82-7 |
| Literature: Gazzetta Chimica Italiana, , vol. 88, p. 1147,1153, 1159 |
|
~%
Ethyl 4,6-dichl... CAS#:53995-82-7 |
| Literature: WO2014/37900 A1, ; |
|
~%
Ethyl 4,6-dichl... CAS#:53995-82-7 |
| Literature: Organic Process Research and Development, , vol. 4, # 6 p. 477 - 487 |
|
~%
Ethyl 4,6-dichl... CAS#:53995-82-7 |
| Literature: WO2014/37900 A1, ; |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 4,6-dichloro-1H-indole-2-carboxylate |
| MFCD00800654 |
| 1H-Indole-2-carboxylic acid, 4,6-dichloro-, ethyl ester |