Ethyl 2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylate structure
|
Common Name | Ethyl 2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 54001-12-6 | Molecular Weight | 281.75800 | |
| Density | 1.28g/cm3 | Boiling Point | 396.4ºC at 760 mmHg | |
| Molecular Formula | C13H12ClNO2S | Melting Point | 83-85ºC | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | Ethyl 2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 396.4ºC at 760 mmHg |
| Melting Point | 83-85ºC |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.75800 |
| Flash Point | 193.6ºC |
| Exact Mass | 281.02800 |
| PSA | 67.43000 |
| LogP | 3.94860 |
| Index of Refraction | 1.582 |
| InChIKey | GQDMHBKOGBVDJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(-c2ccc(Cl)cc2)nc1C |
| HS Code | 2934100090 |
|---|
|
~%
Ethyl 2-(4-chlo... CAS#:54001-12-6 |
| Literature: Justus Liebigs Annalen der Chemie, , p. 1195 - 1205 |
|
~%
Ethyl 2-(4-chlo... CAS#:54001-12-6 |
| Literature: Heterocycles, , vol. 89, # 2 p. 453 - 464 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(4-chloro-phenyl)-4-methyl-thiazole-5-carboxylic acid ethyl ester |
| 2-(4-chlorophenyl)-4-methylthiazole-5-carboxylic acid |