2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carbonyl chloride structure
|
Common Name | 2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 54001-22-8 | Molecular Weight | 272.15000 | |
| Density | 1.417g/cm3 | Boiling Point | 395.6ºC at 760mmHg | |
| Molecular Formula | C11H7Cl2NOS | Melting Point | 180ºC | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | 2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carbonyl chloride |
|---|
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 395.6ºC at 760mmHg |
| Melting Point | 180ºC |
| Molecular Formula | C11H7Cl2NOS |
| Molecular Weight | 272.15000 |
| Flash Point | 193.1ºC |
| Exact Mass | 270.96300 |
| PSA | 58.20000 |
| LogP | 4.15090 |
| Index of Refraction | 1.617 |
| InChIKey | BCMARAXFBBVCJE-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)Cl |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |