2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid structure
|
Common Name | 2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 54001-17-1 | Molecular Weight | 253.70500 | |
| Density | 1.423 g/cm3 | Boiling Point | 445.8ºC at 760 mmHg | |
| Molecular Formula | C11H8ClNO2S | Melting Point | 268-269ºC | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | 2-(4-chlorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.423 g/cm3 |
|---|---|
| Boiling Point | 445.8ºC at 760 mmHg |
| Melting Point | 268-269ºC |
| Molecular Formula | C11H8ClNO2S |
| Molecular Weight | 253.70500 |
| Flash Point | 223.4ºC |
| Exact Mass | 252.99600 |
| PSA | 78.43000 |
| LogP | 3.47010 |
| InChIKey | LZNWUXDMQPUUDR-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1C(=O)O |
| HS Code | 2934100090 |
|---|
|
~94%
2-(4-chlorophen... CAS#:54001-17-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 50, # 4 p. 685 - 695 |
|
~80%
2-(4-chlorophen... CAS#:54001-17-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 51, # 15 p. 4660 - 4671 |
|
~%
2-(4-chlorophen... CAS#:54001-17-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 50, # 4 p. 685 - 695 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(4-chloro-phenyl)-4-methyl-thiazole-5-carboxylic acid |
| 2-(2-FUROYLAMINO)-1,3-OXAZOLE-4-CARBOXYLIC ACID |
| 4-methyl-2-(4-chlorophenyl)-1,3-thiazol-5-carboxylic acid |
| 4-methyl-2-(4-chlorophenyl)-5-thiazolecarboxylic acid |
| HMS2721K11 |
| BB_SC-5038 |