N-(2-furylmethyl)-9-methyl-purin-6-amine structure
|
Common Name | N-(2-furylmethyl)-9-methyl-purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 5401-70-7 | Molecular Weight | 229.23800 | |
| Density | 1.43g/cm3 | Boiling Point | 435.9ºC at 760 mmHg | |
| Molecular Formula | C11H11N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.4ºC | |
| Name | N-(furan-2-ylmethyl)-9-methylpurin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 435.9ºC at 760 mmHg |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.23800 |
| Flash Point | 217.4ºC |
| Exact Mass | 229.09600 |
| PSA | 68.77000 |
| LogP | 1.64140 |
| Index of Refraction | 1.719 |
| InChIKey | RGMVFYIAYDVJCK-UHFFFAOYSA-N |
| SMILES | Cn1cnc2c(NCc3ccco3)ncnc21 |
| HS Code | 2934999090 |
|---|
|
~%
N-(2-furylmethy... CAS#:5401-70-7 |
| Literature: Robins; Lin Journal of the American Chemical Society, 1957 , vol. 79, p. 490,493 |
|
~%
N-(2-furylmethy... CAS#:5401-70-7 |
| Literature: Robins; Lin Journal of the American Chemical Society, 1957 , vol. 79, p. 490,493 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-Methyl-kinetin |
| n-(2-furylmethyl)-n-(9-methyl-9h-purin-6-yl)amine |
| furfuryl-(9-methyl-9H-purin-6-yl)-amine |
| HMS2268J14 |