5-(3 4-DICHLOROPHENYL)-2-FURONIC ACID structure
|
Common Name | 5-(3 4-DICHLOROPHENYL)-2-FURONIC ACID | ||
|---|---|---|---|---|
| CAS Number | 54023-01-7 | Molecular Weight | 257.07000 | |
| Density | 1.477g/cm3 | Boiling Point | 425ºC at 760 mmHg | |
| Molecular Formula | C11H6Cl2O3 | Melting Point | 236-240ºC(lit.) | |
| MSDS | USA | Flash Point | 210.8ºC | |
| Name | 5-(3,4-dichlorophenyl)furan-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477g/cm3 |
|---|---|
| Boiling Point | 425ºC at 760 mmHg |
| Melting Point | 236-240ºC(lit.) |
| Molecular Formula | C11H6Cl2O3 |
| Molecular Weight | 257.07000 |
| Flash Point | 210.8ºC |
| Exact Mass | 255.96900 |
| PSA | 50.44000 |
| LogP | 3.95160 |
| Index of Refraction | 1.604 |
| InChIKey | GNXLBNMHCYYSPU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932190090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-(3,4-Dichlorophenyl)-2-furoic acid |
| 5-(3,4-Dichlorphenyl)-2-furancarbonsaeure |
| 5-(3,4-dichloro-phenyl)-furan-2-carboxylic acid |
| MFCD02257992 |