BENZENEMETHANOL, 4-NITRO-.ALPHA.-(TRICHLOROMETHYL)
BENZENEMETHANOL, 4-NITRO-.ALPHA.-(TRICHLOROMETHYL) structure
|
Common Name | BENZENEMETHANOL, 4-NITRO-.ALPHA.-(TRICHLOROMETHYL) | ||
|---|---|---|---|---|
| CAS Number | 54075-25-1 | Molecular Weight | 270.49700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6Cl3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-nitro-α-(trichloromethyl)benzyl alcohol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6Cl3NO3 |
|---|---|
| Molecular Weight | 270.49700 |
| Exact Mass | 268.94100 |
| PSA | 66.05000 |
| LogP | 3.52160 |
| InChIKey | RWHUHQMPXMQXDN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C(O)C(Cl)(Cl)Cl)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:555-16-8
CAS#:10098-39-2
CAS#:34006-49-0
CAS#:104-03-0
CAS#:4714-32-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2,2-trichloro-1-(4-nitrophenyl)ethanol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-nitro-α-(trichloromethyl)benzyl alcohol? |
| A: LogP of 4-nitro-α-(trichloromethyl)benzyl alcohol is 3.52160. |
| Q: What is the InChIKey of 4-nitro-α-(trichloromethyl)benzyl alcohol? |
| A: InChIKey of 4-nitro-α-(trichloromethyl)benzyl alcohol is RWHUHQMPXMQXDN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-nitro-α-(trichloromethyl)benzyl alcohol? |
| A: SMILES notation of 4-nitro-α-(trichloromethyl)benzyl alcohol is O=[N+]([O-])c1ccc(C(O)C(Cl)(Cl)Cl)cc1. |
| Q: What is the Chinese name of 54075-25-1? |
| A: Chinese name of 54075-25-1 is 54075-25-1. |
| Q: What is the English name of 4-nitro-α-(trichloromethyl)benzyl alcohol? |
| A: The English name of 4-nitro-α-(trichloromethyl)benzyl alcohol is 4-nitro-α-(trichloromethyl)benzyl alcohol. |
| Q: What is the molecular weight of 4-nitro-α-(trichloromethyl)benzyl alcohol? |
| A: Molecular weight of 4-nitro-α-(trichloromethyl)benzyl alcohol is 270.49700. |
| Q: What is the molecular formula of 4-nitro-α-(trichloromethyl)benzyl alcohol? |
| A: Molecular formula of 4-nitro-α-(trichloromethyl)benzyl alcohol is C8H6Cl3NO3. |
| Q: What is the CAS number of 4-nitro-α-(trichloromethyl)benzyl alcohol? |
| A: CAS number of 4-nitro-α-(trichloromethyl)benzyl alcohol is 54075-25-1. |
| Q: What is the polar surface area (PSA) of 4-nitro-α-(trichloromethyl)benzyl alcohol? |
| A: Polar surface area (PSA) of 4-nitro-α-(trichloromethyl)benzyl alcohol is 66.05000. |
| Q: What English synonyms does 4-nitro-α-(trichloromethyl)benzyl alcohol have? |
| A: English synonyms of 4-nitro-α-(trichloromethyl)benzyl alcohol: 2,2,2-trichloro-1-(4-nitrophenyl)ethanol. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |