N-(5-chloro-3-nitropyridin-2-yl)-2,2,2-trifluoroacetamide structure
|
Common Name | N-(5-chloro-3-nitropyridin-2-yl)-2,2,2-trifluoroacetamide | ||
|---|---|---|---|---|
| CAS Number | 35195-91-6 | Molecular Weight | 269.56500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3ClF3N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-chloro-3-nitropyridin-2-yl)-2,2,2-trifluoroacetamide |
|---|
| Molecular Formula | C7H3ClF3N3O3 |
|---|---|
| Molecular Weight | 269.56500 |
| Exact Mass | 268.98200 |
| PSA | 91.30000 |
| LogP | 3.31670 |
| InChIKey | QLCLLKCOKMEPIR-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ncc(Cl)cc1[N+](=O)[O-])C(F)(F)F |
|
~%
N-(5-chloro-3-n... CAS#:35195-91-6 |
| Literature: Eli Lilly and Company Patent: US4087432 A1, 1978 ; |
|
~82%
N-(5-chloro-3-n... CAS#:35195-91-6 |
| Literature: Cundy, Darren J.; Holan, George; Otaegui, Michelle; Simpson, Gregory W. Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 6 p. 669 - 674 |
|
~%
N-(5-chloro-3-n... CAS#:35195-91-6 |
| Literature: Cundy, Darren J.; Holan, George; Otaegui, Michelle; Simpson, Gregory W. Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 6 p. 669 - 674 |