4-[(6-chloro-2-methoxy-acridin-9-yl)amino]phenol structure
|
Common Name | 4-[(6-chloro-2-methoxy-acridin-9-yl)amino]phenol | ||
|---|---|---|---|---|
| CAS Number | 5409-67-6 | Molecular Weight | 350.79800 | |
| Density | 1.395g/cm3 | Boiling Point | 524.5ºC at 760 mmHg | |
| Molecular Formula | C20H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271ºC | |
| Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.395g/cm3 |
|---|---|
| Boiling Point | 524.5ºC at 760 mmHg |
| Molecular Formula | C20H15ClN2O2 |
| Molecular Weight | 350.79800 |
| Flash Point | 271ºC |
| Exact Mass | 350.08200 |
| PSA | 54.38000 |
| LogP | 5.57220 |
| Index of Refraction | 1.754 |
| InChIKey | SAEIEYREYSNRQA-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(O)cc3)c2c1 |
|
~%
4-[(6-chloro-2-... CAS#:5409-67-6 |
| Literature: Burckhalter et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 1363,1372 Journal of the American Chemical Society, 1950 , vol. 72, p. 1024 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(6-Chlor-2-methoxy-acridin-9-ylamino)-phenol |
| 4-(6-chloro-2-methoxy-acridin-9-ylamino)-phenol |
| GNF-Pf-1378 |