Di-tert-Butyl malonate structure
|
Common Name | Di-tert-Butyl malonate | ||
|---|---|---|---|---|
| CAS Number | 541-16-2 | Molecular Weight | 216.274 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 217.6±0.0 °C at 760 mmHg | |
| Molecular Formula | C11H20O4 | Melting Point | −7-−6 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 88.9±0.0 °C | |
| Name | Di-tert-Butyl malonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 217.6±0.0 °C at 760 mmHg |
| Melting Point | −7-−6 °C(lit.) |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.274 |
| Flash Point | 88.9±0.0 °C |
| Exact Mass | 216.136154 |
| PSA | 52.60000 |
| LogP | 2.10 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.433 |
| InChIKey | CLPHAYNBNTVRDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S23-S24/25 |
| WGK Germany | 3 |
| HS Code | 29171910 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Total synthesis of (+/-)- and (-)-actinophyllic acid.
J. Am. Chem. Soc. 132(13) , 4894-906, (2010) Development of efficient sequences for the total syntheses of (+/-)-actinophyllic acid (rac-1) and (-)-actinophyllic acid (1) are described. The central step in these syntheses is the aza-Cope/Mannich... |
|
|
Monomeric malonate precursors for the MOCVD of HfO2 and ZrO2 thin films.
Dalton Trans. (4) , 654-63, (2009) New Hf and Zr malonate complexes have been synthesized by the reaction of metal amides with different malonate ligands (L = dimethyl malonate (Hdmml), diethyl malonate (Hdeml), di-tert-butyl malonate ... |
| Di-tert-Butyl malona |
| Di-tetr butyl malonate |
| di-tert-butyl propadioic acid |
| Di-tert-butylmalonate |
| Malonic Acid Di-tert-butyl Ester |
| Malonic acid di-tert-butyl |
| MALONIC ACID DI-T-BUTYL ESTER |
| Bis(2-methyl-2-propanyl) malonate |
| tert-butoxycarbonyl anhydride |
| EINECS 208-769-6 |
| di-tert-butyl pyrocarbonate |
| Di-tert-butyl malonate |
| MFCD00008810 |
| DI-T-BUTYL MALONATE |
| tert-butyl malonate |
| Di-tert-B-butyl malonate |
| Propanedioic acid, bis(1,1-dimethylethyl) ester |